CAS 711602-67-4

[2,5-bis(trifluoromethyl)phenyl]hydrazine

Description:

[2,5-bis(trifluoromethyl)phenyl]hydrazine is an organic compound characterized by its hydrazine functional group attached to a phenyl ring that has two trifluoromethyl substituents at the 2 and 5 positions. This structure imparts unique properties, including increased lipophilicity and potential reactivity due to the presence of the electronegative fluorine atoms, which can influence the compound's electronic characteristics and stability. The trifluoromethyl groups enhance the compound's resistance to oxidation and can also affect its solubility in various solvents. As a hydrazine derivative, it may exhibit properties typical of hydrazines, such as potential use in organic synthesis, as a reducing agent, or in the development of pharmaceuticals. However, due to the presence of fluorinated groups, it may also possess specific environmental and health considerations, necessitating careful handling and assessment of its safety profile. Overall, [2,5-bis(trifluoromethyl)phenyl]hydrazine is a compound of interest in both industrial and research applications, particularly in the fields of materials science and medicinal chemistry.

Formula: C₈H₆F₆N₂

InChI: InChI=1/C8H6F6N2/c9-7(10,11)4-1-2-5(8(12,13)14)6(3-4)16-15/h1-3,16H,15H2

SMILES: c1cc(c(cc1C(F)(F)F)NN)C(F)(F)F

Synonyms:

• Hydrazine, [2,5-Bis(Trifluoromethyl)Phenyl]-
• [2,5-Bis(trifluoromethyl)phenyl]hydrazine

(2,5-Bis(trifluoromethyl)phenyl)hydrazine

CAS: 711602-67-4

Formula: C₈H₆F₆N₂

Molecular weight: 244.1371

Ref: IN-DA005KOW