CAS 71162-52-2

N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]formamide

Description:

N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]formamide, with the CAS number 71162-52-2, is a chemical compound characterized by its unique structure, which includes a formamide functional group and a hydroxyethyl moiety attached to a dichlorophenyl ring. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The dichlorophenyl substituent contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant interactions with biological systems. The presence of the formamide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may display specific reactivity patterns typical of amides, such as undergoing hydrolysis under certain conditions. Overall, N-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]formamide is of interest in various fields, including organic synthesis and drug development, due to its structural features and potential biological implications.

Formula: C₉H₉Cl₂NO₂

InChI: InChI=1/C9H9Cl2NO2/c10-6-1-2-7(8(11)3-6)9(14)4-12-5-13/h1-3,5,9,14H,4H2,(H,12,13)

SMILES: c1cc(c(cc1Cl)Cl)C(CN=CO)O

N-[2-(2,4-Dichlorophenyl)-2-hydroxyethyl]formamide

CAS: 71162-52-2

Please enquire for more information about N-[2-(2,4-Dichlorophenyl)-2-hydroxyethyl]formamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₉Cl₂NO₂

Purity: Min. 95%

Molecular weight: 234.08 g/mol

Ref: 3D-WCA16252