CAS 71162-56-6
:3-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]imidazolidin-4-one 3-oxide
Description:
3-[2-(2,4-Dichlorophenyl)-2-hydroxyethyl]imidazolidin-4-one 3-oxide, with the CAS number 71162-56-6, is a chemical compound that belongs to the class of imidazolidinones. This substance features a five-membered heterocyclic ring containing nitrogen atoms, which contributes to its biological activity. The presence of a dichlorophenyl group indicates that it has significant hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. The hydroxyethyl substituent enhances its potential for hydrogen bonding, possibly affecting its reactivity and stability. Additionally, the 3-oxide functional group suggests that the compound may exhibit unique redox properties, which could be relevant in various chemical reactions or biological processes. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and safety profile. As with any chemical, proper handling and safety measures should be observed due to potential toxicity or environmental impact.
Formula:C11H12Cl2N2O3
InChI:InChI=1/C11H12Cl2N2O3/c12-7-1-2-8(9(13)3-7)10(16)5-15(18)6-14-4-11(15)17/h1-3,10,14,16H,4-6H2
SMILES:c1cc(c(cc1Cl)Cl)C(CN1(=O)CNCC1=O)O
Synonyms:- 3-(2-(2,4-Dichlorophenyl)-2-hydroxyethyl)-3,4-imidazolidinedione
- 3,4-Imidazolidinedione, 3-(2-(2,4-dichlorophenyl)-2-hydroxyethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-(2-(2,4-Dichlorophenyl)-2-hydroxyethyl)-3,4-imidazolidinedione
CAS:3-(2-(2,4-Dichlorophenyl)-2-hydroxyethyl)-3,4-imidazolidinedione is a synthetic compound, which is a derivative of imidazolidinedione. It is primarily characterized as an antifungal agent with broad-spectrum activity against various fungal species. Its mode of action involves disrupting the synthesis of ergosterol, an essential component of fungal cell membranes. This disruption leads to increased membrane permeability and ultimately, cell death. The efficacy of this compound is attributed to its ability to inhibit the growth of pathogens by targeting critical pathways necessary for fungal survival.
Formula:C11H12Cl2N2O3Purity:Min. 95%Molecular weight:291.13 g/molRef: 3D-WCA16256
Discontinued product


