CAS 71164-40-4
:1H,1H,2H-Heptafluoropentene-1
Description:
1H,1H,2H-Heptafluoropentene-1, with the CAS number 71164-40-4, is a fluorinated organic compound characterized by its unique structure that includes multiple fluorine atoms attached to a pentene backbone. This compound is part of the class of perfluorinated alkenes, which are known for their high stability and resistance to chemical reactions due to the strong carbon-fluorine bonds. It typically appears as a colorless gas or liquid at room temperature and has low volatility. The presence of fluorine atoms imparts significant hydrophobic and lipophobic properties, making it useful in various applications, including as a refrigerant, in specialty coatings, and in the production of fluorinated polymers. Additionally, its reactivity can be influenced by the presence of the double bond, allowing for potential polymerization or other chemical transformations under specific conditions. Safety considerations are paramount when handling this compound, as fluorinated compounds can pose environmental and health risks.
Formula:C5H3F7
InChI:InChI=1/C5H3F7/c1-2-3(6,7)4(8,9)5(10,11)12/h2H,1H2
SMILES:C=CC(C(C(F)(F)F)(F)F)(F)F
Synonyms:- 3,3,4,4,5,5,5-Heptafluoro-1-pentene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.