CAS 7117-31-9
:1-methyl-1H-2,1-benzothiazin-4(3H)-one 2,2-dioxide
Description:
1-Methyl-1H-2,1-benzothiazin-4(3H)-one 2,2-dioxide, with the CAS number 7117-31-9, is a heterocyclic compound characterized by its benzothiazine structure, which includes a sulfur atom and a nitrogen atom within a fused ring system. This compound typically exhibits a pale yellow to white crystalline appearance and is known for its potential biological activity, particularly in medicinal chemistry. It is soluble in organic solvents and may have limited solubility in water, which can influence its bioavailability and pharmacokinetic properties. The presence of the methyl group and the sulfonyl moiety contributes to its chemical reactivity and stability. This compound has been studied for its potential applications in pharmaceuticals, particularly as an antimicrobial or anti-inflammatory agent. Its unique structural features allow for various chemical modifications, which can enhance its therapeutic efficacy. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings.
Formula:C9H9NO3S
InChI:InChI=1/C9H9NO3S/c1-10-8-5-3-2-4-7(8)9(11)6-14(10,12)13/h2-5H,6H2,1H3
SMILES:CN1c2ccccc2C(=O)CS1(=O)=O
Synonyms:- 1H-2,1-Benzothiazin-4(3H)-one, 1-methyl-, 2,2-dioxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Methyl-1H-2,1-benzothiazin-4(3H)-one 2,2-dioxide
CAS:1-Methyl-1H-2,1-benzothiazin-4(3H)-one 2,2-dioxideFormula:C9H9NO3SPurity:97% (Typical Value in Batch COA)Color and Shape: off-white to pale yellow crystalline solidMolecular weight:211.24g/mol2,2-Dioxo-1-methyl-2,1-benzothiazin-4(3H)-one
CAS:Formula:C9H9NO3SColor and Shape:SolidMolecular weight:211.241-Methyl-1,2,3,4-tetrahydro-2lambda~6~,1-benzothiazine-2,2,4-trione
CAS:1-Methyl-1,2,3,4-tetrahydro-2lambda~6~,1-benzothiazine-2,2,4-trione is a heterocyclic compound that contains a benzene ring and a heterocyclic ring. It has an asymmetric carbon atom with two different substituents (a hydrogen and a sulfonyl group). The carbonyl group is bonded to the sulfur atom of the sulfonyl group. The molecule also has two hydrogen bonds in its geometry. This molecule has a dimerized conformation and can be found as a dimerized crystal structure.Formula:C9H9NO3SPurity:Min. 95%Molecular weight:211.24 g/mol


