CymitQuimica logo

CAS 71171-92-1

:

8-fluorobenzo[pqr]tetraphene

Description:
8-Fluorobenzo[pqr]tetraphene is a polycyclic aromatic hydrocarbon characterized by its complex fused ring structure, which includes four interconnected benzene rings. The presence of a fluorine atom at the 8-position of the tetraphene framework introduces unique electronic and steric properties, potentially influencing its reactivity and interactions with other molecules. This compound is typically studied for its photophysical properties, including fluorescence and absorption characteristics, which can be affected by the fluorine substitution. Additionally, 8-fluorobenzo[pqr]tetraphene may exhibit interesting behavior in organic electronic applications, such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs), due to its extended π-conjugation. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques like NMR spectroscopy, mass spectrometry, and UV-Vis spectroscopy to confirm its structure and purity. As with many polycyclic aromatic compounds, considerations regarding its environmental impact and potential toxicity are important in both research and application contexts.
Formula:C20H11F
InChI:InChI=1/C20H11F/c21-16-7-9-17-15(11-16)10-14-5-4-12-2-1-3-13-6-8-18(17)20(14)19(12)13/h1-11H
SMILES:c1cc2ccc3cc4cc(ccc4c4ccc(c1)c2c34)F
Synonyms:
  • Benzo[A]Pyrene, 8-Fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.