CymitQuimica logo

CAS 71171-93-2

:

9-fluorobenzo[pqr]tetraphene

Description:
9-Fluorobenzo[pqr]tetraphene is a polycyclic aromatic hydrocarbon characterized by its complex fused ring structure, which includes four interconnected benzene rings and a fluorine atom substituent. This compound exhibits notable properties typical of polycyclic aromatics, such as high stability and a tendency to exhibit strong fluorescence. The presence of the fluorine atom can influence its electronic properties, potentially enhancing its reactivity and altering its photophysical behavior compared to its non-fluorinated analogs. 9-Fluorobenzo[pqr]tetraphene is of interest in various fields, including materials science and organic electronics, due to its potential applications in organic semiconductors and light-emitting devices. Additionally, its unique structure may contribute to interesting interactions with biological systems, making it a subject of study in medicinal chemistry. The compound's synthesis and characterization are essential for understanding its properties and potential applications, and ongoing research may reveal further insights into its behavior and utility in advanced materials.
Formula:C20H11F
InChI:InChI=1/C20H11F/c21-16-8-6-14-10-15-5-4-12-2-1-3-13-7-9-17(18(14)11-16)20(15)19(12)13/h1-11H
SMILES:c1cc2ccc3cc4ccc(cc4c4ccc(c1)c2c34)F
Synonyms:
  • Benzo[A]Pyrene, 9-Fluoro-
  • 9-Fluorobenzo[pqr]tetraphene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.