CymitQuimica logo

CAS 71172-13-9

:

10-fluoro-7,12-dimethyltetraphene

Description:
10-Fluoro-7,12-dimethyltetraphene is an organic compound characterized by its polycyclic aromatic structure, which consists of four fused benzene rings. The presence of a fluorine atom at the 10-position and two methyl groups at the 7 and 12 positions contributes to its unique chemical properties. This compound is typically non-polar and exhibits significant hydrophobic characteristics due to its large aromatic system. It may display interesting electronic properties, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). The fluorine substitution can enhance the stability and solubility of the compound in various solvents. Additionally, its structure may influence its photophysical properties, including absorption and emission spectra. As with many polycyclic aromatic hydrocarbons, it is essential to consider its potential environmental and health impacts, as some related compounds are known to be carcinogenic. Overall, 10-fluoro-7,12-dimethyltetraphene represents a fascinating subject for research in organic chemistry and materials science.
Formula:C20H15F
InChI:InChI=1/C20H15F/c1-12-16-10-8-15(21)11-19(16)13(2)20-17(12)9-7-14-5-3-4-6-18(14)20/h3-11H,1-2H3
SMILES:Cc1c2ccc(cc2c(C)c2c1ccc1ccccc21)F
Synonyms:
  • Benz[A]Anthracene, 10-Fluoro-7,12-Dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.