CAS 71172-23-1
:1,1'-hex-2-yne-1,6-diyldipyrrolidine
Description:
1,1'-Hex-2-yne-1,6-diyldipyrrolidine, identified by its CAS number 71172-23-1, is a chemical compound characterized by its unique structure that includes a hex-2-yne moiety and two pyrrolidine rings. This compound features a linear alkyne with a triple bond between the second and third carbon atoms of a six-carbon chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the pyrrolidine rings, which are five-membered nitrogen-containing heterocycles, adds to the compound's basicity and potential for forming coordination complexes. The overall structure suggests that it may exhibit interesting properties such as solubility in organic solvents and the ability to participate in various chemical reactions, including cycloadditions and nucleophilic substitutions. Additionally, the presence of multiple functional groups may influence its biological activity, making it a candidate for further research in medicinal chemistry. However, specific data regarding its physical properties, reactivity, and safety profile would require further investigation and characterization.
Formula:C14H24N2
InChI:InChI=1/C14H24N2/c1(3-9-15-11-5-6-12-15)2-4-10-16-13-7-8-14-16/h1,3,5-14H2
SMILES:C(C#CCN1CCCC1)CCN1CCCC1
Synonyms:- 1-(6-(1-Pyrrolidinyl)-4-hexynyl)pyrrolidine
- Pyrrolidine, 1,1'-(2-Hexyne-1,6-Diyl)Bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.