CAS 71172-25-3
:2,6-dimethyl-1,4-oxathiane
Description:
2,6-Dimethyl-1,4-oxathiane is a heterocyclic organic compound characterized by a six-membered ring containing both sulfur and oxygen atoms. The structure features a thiane ring, which is a saturated cyclic compound with a sulfur atom, and an oxygen atom incorporated into the ring, specifically at the 1 and 4 positions. This compound has two methyl groups attached to the 2 and 6 positions of the ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the sulfur atom imparts certain reactivity, making it susceptible to oxidation and other chemical transformations. 2,6-Dimethyl-1,4-oxathiane may exhibit interesting biological activities, although specific applications or uses may vary. Its solubility in organic solvents and relatively low boiling point suggest potential utility in organic synthesis and as a building block in the development of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H12OS
InChI:InChI=1/C6H12OS/c1-5-3-8-4-6(2)7-5/h5-6H,3-4H2,1-2H3
SMILES:CC1CSCC(C)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.