CAS 71172-40-2
:ethyl N-cyano-N-methylglycinate
Description:
Ethyl N-cyano-N-methylglycinate, with the CAS number 71172-40-2, is an organic compound characterized by its structure, which includes an ethyl ester group, a cyano group, and a methylglycine moiety. This compound is typically a colorless to pale yellow liquid and is known for its moderate volatility and solubility in organic solvents. It exhibits properties typical of esters and nitriles, such as reactivity in nucleophilic substitution reactions. Ethyl N-cyano-N-methylglycinate is often utilized in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in the formation of more complex molecules. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if inhaled or ingested, and appropriate safety measures should be taken during its use in laboratory or industrial settings.
Formula:C6H10N2O2
InChI:InChI=1/C6H10N2O2/c1-3-10-6(9)4-8(2)5-7/h3-4H2,1-2H3
SMILES:CCOC(=O)CN(C)C#N
Synonyms:- glycine, N-cyano-N-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.