
CAS 71172-46-8
:α-Methyl-α-(1-methylcyclopropyl)benzenemethanol
Description:
α-Methyl-α-(1-methylcyclopropyl)benzenemethanol, with the CAS number 71172-46-8, is an organic compound characterized by its complex structure that includes a benzene ring, a cyclopropyl group, and a hydroxymethyl functional group. This compound is a type of alcohol, specifically a benzenemethanol derivative, which suggests it possesses both hydrophobic and hydrophilic properties due to the presence of the aromatic ring and the hydroxyl (-OH) group. The methyl and cyclopropyl substituents contribute to its steric hindrance and influence its reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry. Additionally, the presence of multiple functional groups can lead to diverse chemical behavior, including potential for hydrogen bonding and interactions with other molecules. Overall, α-Methyl-α-(1-methylcyclopropyl)benzenemethanol is a structurally intriguing compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H16O
InChI:InChI=1S/C12H16O/c1-11(8-9-11)12(2,13)10-6-4-3-5-7-10/h3-7,13H,8-9H2,1-2H3
InChI key:InChIKey=JKVXNQHAQDPGRQ-UHFFFAOYSA-N
SMILES:C(C)(O)(C1(C)CC1)C2=CC=CC=C2
Synonyms:- Benzenemethanol, α-methyl-α-(1-methylcyclopropyl)-
- α-Methyl-α-(1-methylcyclopropyl)benzenemethanol
- 1-(1-Methylcyclopropyl)-1-phenylethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.