
CAS 71172-47-9
:α,α-Dicyclopropyl-4-methylbenzenemethanol
Description:
α,α-Dicyclopropyl-4-methylbenzenemethanol, with the CAS number 71172-47-9, is an organic compound characterized by its unique molecular structure, which includes a benzene ring substituted with a methyl group and two cyclopropyl groups. This compound is typically a colorless to pale yellow liquid, exhibiting a relatively low volatility due to its larger molecular size. It is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. The presence of the cyclopropyl groups contributes to its distinctive chemical reactivity, making it a subject of interest in studies related to strain and stability in cyclic compounds. Additionally, the hydroxyl group in the alcohol functional group can participate in hydrogen bonding, influencing its solubility and interaction with other chemical species. Overall, α,α-Dicyclopropyl-4-methylbenzenemethanol is notable for its structural complexity and potential utility in various chemical applications.
Formula:C14H18O
InChI:InChI=1S/C14H18O/c1-10-2-4-11(5-3-10)14(15,12-6-7-12)13-8-9-13/h2-5,12-13,15H,6-9H2,1H3
InChI key:InChIKey=ZLDYBMZGEIJXHG-UHFFFAOYSA-N
SMILES:C(O)(C1CC1)(C2CC2)C3=CC=C(C)C=C3
Synonyms:- α,α-Dicyclopropyl-4-methylbenzenemethanol
- Benzenemethanol, α,α-dicyclopropyl-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.