CAS 71172-53-7

(2E)-2,5-dimethylhex-2-ene-1,6-diyl diacetate

Description:

(2E)-2,5-dimethylhex-2-ene-1,6-diyl diacetate is an organic compound characterized by its structure, which includes a hexene backbone with two methyl groups and two acetate functional groups. This compound features a double bond between the second and third carbon atoms, contributing to its unsaturation and reactivity. The presence of the diacetate groups indicates that the compound has two acetate moieties, which can influence its solubility and reactivity in various chemical environments. Typically, compounds like this may exhibit moderate volatility and can be used in synthetic organic chemistry or as intermediates in the production of more complex molecules. Its specific physical properties, such as boiling point, melting point, and density, would depend on the molecular interactions and the overall structure. Additionally, the compound may have applications in fragrance or flavor industries due to the presence of acetate groups, which are often associated with pleasant aromas. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₂₀O₄

InChI: InChI=1/C12H20O4/c1-9(7-15-11(3)13)5-6-10(2)8-16-12(4)14/h5,10H,6-8H2,1-4H3/b9-5+

Synonyms:

• 2-hexene-1,6-diol, 2,5-dimethyl-, diacetate, (2E)-