CAS 71172-60-6
:3-(1-Piperidinylmethyl)bicyclo[2.2.1]heptan-2-one
Description:
3-(1-Piperidinylmethyl)bicyclo[2.2.1]heptan-2-one, with the CAS number 71172-60-6, is a bicyclic compound characterized by its unique bicyclo[2.2.1]heptane structure, which features a ketone functional group at the 2-position and a piperidinylmethyl substituent at the 3-position. This compound exhibits a rigid bicyclic framework that contributes to its potential biological activity and pharmacological properties. The presence of the piperidine ring enhances its ability to interact with biological targets, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties, such as reactivity and stability, can be influenced by the functional groups present, particularly the ketone and piperidine moieties. Overall, this compound is significant in research contexts, particularly in the development of new therapeutic agents, due to its structural features and potential interactions within biological systems.
Formula:C13H21NO
InChI:InChI=1S/C13H21NO/c15-13-11-5-4-10(8-11)12(13)9-14-6-2-1-3-7-14/h10-12H,1-9H2
InChI key:InChIKey=OEAONVDZGJMUKW-UHFFFAOYSA-N
SMILES:C(C1C2CC(C1=O)CC2)N3CCCCC3
Synonyms:- 3-(1-Piperidinylmethyl)bicyclo[2.2.1]heptan-2-one
- 2-Norbornanone, 3-(piperidinomethyl)-
- NSC 84250
- 3-[(Piperidin-1-yl)methyl]bicyclo[2.2.1]heptan-2-one
- Bicyclo[2.2.1]heptan-2-one, 3-(1-piperidinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.