CAS 71172-61-7
:4-[3-chloro-1-(1-methylethoxy)propyl]toluene
Description:
4-[3-Chloro-1-(1-methylethoxy)propyl]toluene, identified by its CAS number 71172-61-7, is an organic compound characterized by its complex structure, which includes a toluene moiety and a chloroalkyl group. This compound typically exhibits properties common to alkyl-substituted aromatic compounds, such as moderate volatility and hydrophobicity. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. The presence of the chloro group suggests potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the 1-(1-methylethoxy) group introduces steric hindrance, which may influence its reactivity and interactions with other chemical species. This compound may be used in various applications, including as an intermediate in organic synthesis or in the production of specialty chemicals. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 4-[3-chloro-1-(1-methylethoxy)propyl]toluene represents a unique structure within the realm of organic chemistry.
Formula:C13H19ClO
InChI:InChI=1/C13H19ClO/c1-10(2)15-13(8-9-14)12-6-4-11(3)5-7-12/h4-7,10,13H,8-9H2,1-3H3
InChI key:InChIKey=DZTPRCOFHITSFQ-UHFFFAOYSA-N
SMILES:C(OC(C)C)(CCCl)C1=CC=C(C)C=C1
Synonyms:- 1-[3-Chloro-1-(1-methylethoxy)propyl]-4-methylbenzene
- 1-[3-Chloro-1-(Propan-2-Yloxy)Propyl]-4-Methylbenzene
- Benzene, 1-[3-chloro-1-(1-methylethoxy)propyl]-4-methyl-
- NSC 63375
- 4-(3-Chloro-1-(1-methylethoxy)propyl)toluene
- 3-ISOPROPOXY-3-(P-TOLYL)-PROPYL CHLORIDE
- Einecs 275-235-7
- 1-(3-chloro-1-propan-2-yloxypropyl)-4-methylbenzene
- 3-Isopropyloxy-3-(p-tolyl)propyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.