CAS 71172-65-1
:N-(2-phenylethoxy)-1-(pyridin-3-yl)methanimine
Description:
N-(2-phenylethoxy)-1-(pyridin-3-yl)methanimine, with the CAS number 71172-65-1, is a chemical compound characterized by its unique structural features, which include a methanimine functional group linked to a pyridine ring and a phenylethoxy moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the pyridine ring suggests basicity and potential coordination with metal ions, while the phenylethoxy group may enhance lipophilicity, influencing its solubility in organic solvents. The compound may also display biological activity, making it of interest in medicinal chemistry. Its synthesis often involves the reaction of appropriate amines and aldehydes, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, N-(2-phenylethoxy)-1-(pyridin-3-yl)methanimine represents a versatile scaffold for further chemical exploration and potential applications in various fields.
Formula:C14H14N2O
InChI:InChI=1/C14H14N2O/c1-2-5-13(6-3-1)8-10-17-16-12-14-7-4-9-15-11-14/h1-7,9,11-12H,8,10H2
SMILES:c1ccc(cc1)CCON=Cc1cccnc1
Synonyms:- 3-pyridinecarboxaldehyde, O-(2-phenylethyl)oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.