CymitQuimica logo

CAS 71172-67-3

:

2,2-diethoxy-N-(pyridin-3-ylmethyl)ethanamine

Description:
2,2-Diethoxy-N-(pyridin-3-ylmethyl)ethanamine is a chemical compound characterized by its unique structure, which includes a diethoxy group and a pyridine moiety. This compound features an ethanamine backbone, where the nitrogen atom is substituted with a pyridin-3-ylmethyl group, contributing to its potential biological activity. The presence of the diethoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. The pyridine ring can participate in various chemical interactions, including hydrogen bonding and coordination with metal ions, making this compound of interest in medicinal chemistry and drug design. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting neurological or psychiatric disorders, given the known effects of pyridine derivatives in these areas. As with many organic compounds, the specific properties such as melting point, boiling point, and solubility would depend on the purity and specific conditions under which the compound is studied.
Formula:C12H20N2O2
InChI:InChI=1/C12H20N2O2/c1-3-15-12(16-4-2)10-14-9-11-6-5-7-13-8-11/h5-8,12,14H,3-4,9-10H2,1-2H3
SMILES:CCOC(CNCc1cccnc1)OCC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.