CAS 71172-68-4

α,α-Dicyclopropylcyclohexanemethanol

Description:

α,α-Dicyclopropylcyclohexanemethanol, with the CAS number 71172-68-4, is a chemical compound characterized by its unique structure that includes a cyclohexane ring substituted with two cyclopropyl groups and a hydroxymethyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to its hydrophobic cyclopropyl and cyclohexane components. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other substances. α,α-Dicyclopropylcyclohexanemethanol may be of interest in various chemical applications, including as a potential intermediate in organic synthesis or in the development of pharmaceuticals. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would need to be determined through experimental data for practical applications. Safety data should also be consulted to ensure proper handling and usage.

Formula: C₁₃H₂₂O

InChI: InChI=1S/C13H22O/c14-13(11-6-7-11,12-8-9-12)10-4-2-1-3-5-10/h10-12,14H,1-9H2

InChI key: InChIKey=JGIFCDXLSBRZQP-UHFFFAOYSA-N

SMILES: C(O)(C1CC1)(C2CC2)C3CCCCC3

Synonyms:

• α,α-Dicyclopropylcyclohexanemethanol
• Cyclohexanemethanol, α,α-dicyclopropyl-