CymitQuimica logo

CAS 71172-77-5

:

2-(piperidin-1-ylmethyl)pyridine

Description:
2-(Piperidin-1-ylmethyl)pyridine, with the CAS number 71172-77-5, is a chemical compound characterized by its pyridine and piperidine functional groups. This compound features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a piperidine moiety, a saturated six-membered ring containing one nitrogen atom. The presence of the piperidine group contributes to its potential as a ligand in coordination chemistry and as a building block in organic synthesis. The compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in polar organic solvents. Its structure allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit biological activity, and its derivatives could be explored for their potential therapeutic effects. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C11H16N2
InChI:InChI=1/C11H16N2/c1-4-8-13(9-5-1)10-11-6-2-3-7-12-11/h2-3,6-7H,1,4-5,8-10H2
SMILES:C1CCN(CC1)Cc1ccccn1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.