CymitQuimica logo

CAS 71173-00-7

:

6-(benzylamino)-2-methylheptan-2-ol

Description:
6-(Benzylamino)-2-methylheptan-2-ol, with the CAS number 71173-00-7, is an organic compound characterized by its complex structure featuring a heptane backbone with a hydroxyl group and a benzylamino substituent. This compound typically exhibits properties associated with alcohols, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in various solvents. The presence of the benzylamino group suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure may impart specific stereochemical configurations, affecting its reactivity and interactions. Additionally, the compound may exhibit moderate to low volatility and stability under standard conditions, although specific reactivity can depend on the functional groups present. Overall, 6-(benzylamino)-2-methylheptan-2-ol is a versatile compound that may find applications in pharmaceuticals or as an intermediate in organic synthesis, although detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H25NO
InChI:InChI=1/C15H25NO/c1-13(8-7-11-15(2,3)17)16-12-14-9-5-4-6-10-14/h4-6,9-10,13,16-17H,7-8,11-12H2,1-3H3
SMILES:CC(CCCC(C)(C)O)NCc1ccccc1
Synonyms:
  • 2-Heptanol, 2-Methyl-6-[(Phenylmethyl)Amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.