CAS 71173-63-2
:L-Histidine, acetate (1:1)
Description:
L-Histidine, acetate (1:1) is a salt formed from the amino acid L-histidine and acetic acid, characterized by its role as a building block in protein synthesis and its involvement in various metabolic processes. L-histidine is an essential amino acid for infants and plays a crucial role in the production of histamine, a neurotransmitter involved in immune responses and gastric acid secretion. The acetate component contributes to the solubility and stability of the compound in aqueous solutions. This substance typically appears as a white crystalline powder and is soluble in water, making it suitable for various biochemical applications, including cell culture and nutritional supplements. Its pH can vary depending on concentration and temperature, but it generally exhibits buffering capacity, which is beneficial in biological systems. Additionally, L-histidine has antioxidant properties and is involved in the synthesis of hemoglobin. As with many amino acids, it is important to handle this compound with care, following appropriate safety guidelines in laboratory settings.
Formula:C6H9N3O2·C2H4O2
InChI:InChI=1S/C6H9N3O2.C2H4O2/c7-5(6(10)11)1-4-2-8-3-9-4;1-2(3)4/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H3,(H,3,4)/t5-;/m0./s1
InChI key:InChIKey=HABAJMUFCIDFOT-JEDNCBNOSA-N
SMILES:C([C@@H](C(O)=O)N)C1=CN=CN1.C(C)(O)=O
Synonyms:- <span class="text-smallcaps">L</span>-Histidine, acetate (1:1)
- <span class="text-smallcaps">L</span>-Histidine, monoacetate
- L-Histidine acetate
- L-Histidine, acetate (1:1)
- L-Histidine, monoacetate
- L-Histidine, monoacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
L-Histidine acetate
CAS:Controlled ProductL-Histidine acetate is a white, crystalline powder that has a constant melting point and can be soluble in water. It has a monoclinic crystal system with a crystal form of α-l-histidine dihydrogen acetate. L-Histidine acetate is an amino acid that is necessary for the biosynthesis of proteins and the metabolism of histamine. L-Histidine acetate has been studied using x-ray diffraction and optical properties to determine its functional groups. The activation energy for this compound is found to be at 4.1 kcal/mol, which is lower than most other compounds in nature. The frequencies of light waves are measured at 3,040 cm-1 and the evaporation rate at 15°C is 0.039 cm3/s.
Formula:C6H9N3O2•C2H4O2Purity:Min. 95%Molecular weight:215.21 g/mol
