CAS 71173-66-5

1-Chloro-3,5-dimethylhexane

Description:

1-Chloro-3,5-dimethylhexane is an organic compound characterized by its structure, which includes a hexane backbone with two methyl groups located at the 3 and 5 positions and a chlorine atom at the 1 position. This compound is classified as a haloalkane, specifically an alkyl halide, due to the presence of the chlorine atom. It is typically a colorless liquid with a distinctive odor, and it is insoluble in water but soluble in organic solvents. The presence of the chlorine atom contributes to its reactivity, making it a potential candidate for nucleophilic substitution reactions. The compound's molecular formula reflects its composition, and its physical properties, such as boiling point and density, can vary based on environmental conditions. 1-Chloro-3,5-dimethylhexane may be used in various chemical syntheses and applications, including as an intermediate in the production of other chemicals. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.

Formula: C₈H₁₇Cl

InChI: InChI=1S/C8H17Cl/c1-7(2)6-8(3)4-5-9/h7-8H,4-6H2,1-3H3

InChI key: InChIKey=CXWJTBOCGYKKIG-UHFFFAOYSA-N

SMILES: C(C(CCCl)C)C(C)C

Synonyms:

• Hexane, 1-chloro-3,5-dimethyl-
• 1-Chloro-3,5-dimethylhexane