CAS 7118-66-3
:6-Methyl-2-(4-methylphenyl)-1H-benzimidazole
Description:
6-Methyl-2-(4-methylphenyl)-1H-benzimidazole is an organic compound characterized by its benzimidazole core, which consists of a fused benzene and imidazole ring. This compound features a methyl group at the 6-position and a para-methylphenyl group at the 2-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methyl groups can influence its electronic properties, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and structural characteristics. Additionally, its CAS number, 7118-66-3, allows for easy identification and reference in chemical databases. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C15H14N2
InChI:InChI=1S/C15H14N2/c1-10-3-6-12(7-4-10)15-16-13-8-5-11(2)9-14(13)17-15/h3-9H,1-2H3,(H,16,17)
InChI key:InChIKey=OPBSAVHQPYKEQP-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=2NC=3C(N2)=CC(C)=CC3)C=C1
Synonyms:- 1H-Benzimidazole, 6-methyl-2-(4-methylphenyl)-
- 1H-benzimidazole, 5-methyl-2-(4-methylphenyl)-
- 5-Methyl-2-(4-methylphenyl)-1H-benzimidazole
- 5-Methyl-2-(4-methylphenyl)benzimidazole
- Benzimidazole, 5-methyl-2-p-tolyl-
- 6-Methyl-2-(4-methylphenyl)-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.