CAS 71183-66-9

threo-Pentaric acid, 3-carboxy-2,3-dideoxy-4-C-methyl-

Description:

Threo-Pentaric acid, 3-carboxy-2,3-dideoxy-4-C-methyl- is a chemical compound characterized by its unique structure, which includes multiple functional groups that contribute to its reactivity and properties. This compound features a carboxylic acid group, which typically imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and neutralization. The presence of dideoxy and C-methyl groups suggests that it may exhibit specific stereochemical configurations, influencing its biological activity and interactions with enzymes or receptors. Additionally, the compound's molecular structure may affect its solubility in different solvents, stability under various conditions, and potential applications in pharmaceuticals or biochemistry. As a compound with a specific CAS number, it is cataloged in chemical databases, facilitating research and development in related fields. Overall, threo-Pentaric acid, 3-carboxy-2,3-dideoxy-4-C-methyl- is of interest for its potential applications and the insights it may provide into the chemistry of similar compounds.

Formula: C₇H₁₀O₇

InChI: InChI=1/C7H10O7/c1-7(14,6(12)13)3(5(10)11)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t3-,7-/s2

InChI key: InChIKey=HHKPKXCSHMJWCF-HCIPMFPINA-N

SMILES: [C@@H]([C@@](C(O)=O)(C)O)(CC(O)=O)C(O)=O

Synonyms:

• DL-threo-Pentaric acid, 3-carboxy-2,3-dideoxy-4-C-methyl-
• threo-Pentaric acid, 3-carboxy-2,3-dideoxy-4-C-methyl-

DL-threo-2-methylisocitrate sodium salt

CAS: 71183-66-9

DL-threo-2-methylisocitrate sodium salt is an enzyme substrate for isocitrate lyase 1 (ICL1), an enzyme involved in the glyoxylate cycle, a metabolic pathway that allows organisms to convert acetate into glucose. It is also a substrate for bovine heart aconitase and acts as inhibitor of TPN-linked isocitrate dehydrogenase.

Formula: C₇H₁₀O₇·xNa

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 206.15 g/mol

Ref: 3D-WCA18366

DL-threo-2-methylisocitrate

CAS: 71183-66-9

dl-threo-2-methylisocitrate, substrate for ICL1, has Km of ~752µM, kcat of 1.25s^-1; higher Km and lower kcat than ICA.

Formula: C₇H₁₀O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.15

Ref: TM-T19292