CAS 7119-89-3
:Dichloronitromethane
Description:
Dichloronitromethane, with the CAS number 7119-89-3, is a chemical compound characterized by its molecular structure, which includes two chlorine atoms and a nitro group attached to a methane backbone. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is known for its moderate volatility and relatively low solubility in water, making it more soluble in organic solvents. Dichloronitromethane is primarily used as an intermediate in organic synthesis and can serve as a reagent in various chemical reactions. It exhibits properties such as being a potential environmental pollutant and may pose health risks upon exposure, necessitating proper handling and safety precautions. The compound's reactivity is influenced by the presence of the nitro group, which can participate in electrophilic substitution reactions. Overall, dichloronitromethane is an important compound in the field of synthetic chemistry, although its use is regulated due to potential toxicity and environmental concerns.
Formula:CHCl2NO2
InChI:InChI=1S/CHCl2NO2/c2-1(3)4(5)6/h1H
InChI key:InChIKey=XUNYLLBGLKGFHO-UHFFFAOYSA-N
SMILES:C(N(=O)=O)(Cl)Cl
Synonyms:- Dichloronitromethane
- Dichloropicrin
- Methane, Dichloronitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dichloronitromethane
CAS:Formula:CHCl2NO2Color and Shape:Colourless to Pale Yellow OilMolecular weight:129.93
