
CAS 71193-32-3
:(2R)-2-chloro-1,2-bis(4-methylphenyl)ethanone
Description:
(2R)-2-chloro-1,2-bis(4-methylphenyl)ethanone, with the CAS number 71193-32-3, is an organic compound characterized by its specific stereochemistry and functional groups. This compound features a chloro substituent and two para-methylphenyl groups attached to a central ethanone structure, which contributes to its unique chemical properties. The presence of the chloro group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The para-methyl groups on the phenyl rings can influence the compound's electronic properties and steric hindrance, affecting its interactions with other molecules. This compound may exhibit moderate to high lipophilicity due to its aromatic structure, which can impact its solubility in organic solvents. Additionally, its stereochemistry may play a crucial role in its biological activity, making it of interest in medicinal chemistry. Overall, (2R)-2-chloro-1,2-bis(4-methylphenyl)ethanone is a versatile compound with potential applications in organic synthesis and pharmaceuticals.
Formula:C16H15ClO
InChI:InChI=1/C16H15ClO/c1-11-3-7-13(8-4-11)15(17)16(18)14-9-5-12(2)6-10-14/h3-10,15H,1-2H3/t15-/m1/s1
SMILES:Cc1ccc(cc1)[C@H](C(=O)c1ccc(C)cc1)Cl
Synonyms:- 2-chloro-1,2-bis(4-methylphenyl)ethanone
- Ethanone,2-chloro-1,2-bis(4-Methylphenyl)-
- 2-Chloro-1,2-Bis(4-Methylphenyl)Ethan-1-One
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.