CAS 71195-77-2
:propan-2-yl 6-chlorohexanoate
Description:
Propan-2-yl 6-chlorohexanoate, also known as isopropyl 6-chlorohexanoate, is an ester formed from the reaction of isopropanol and 6-chlorohexanoic acid. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic alkyl chain. The presence of the chlorine atom in its structure can impart unique reactivity, making it useful in various chemical syntheses and applications. Propan-2-yl 6-chlorohexanoate may exhibit moderate toxicity, and appropriate safety measures should be taken when handling it, including the use of personal protective equipment. Its applications can range from use as an intermediate in organic synthesis to potential roles in the development of pharmaceuticals or agrochemicals. As with all chemical substances, proper storage and disposal according to regulatory guidelines are essential to ensure safety and environmental protection.
Formula:C9H17ClO2
InChI:InChI=1/C9H17ClO2/c1-8(2)12-9(11)6-4-3-5-7-10/h8H,3-7H2,1-2H3
SMILES:CC(C)OC(=O)CCCCCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.