CAS 712-08-3

1-(5-fluoro-1H-indol-3-yl)propan-2-aminium chloride

Description:

1-(5-Fluoro-1H-indol-3-yl)propan-2-aminium chloride, with the CAS number 712-08-3, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position of the indole ring contributes to its unique properties, potentially influencing its biological activity and reactivity. The compound features a propan-2-aminium group, indicating that it possesses a quaternary ammonium structure, which typically enhances solubility in polar solvents and may impart cationic characteristics. As a chloride salt, it is likely to be soluble in water, making it suitable for various applications in medicinal chemistry and pharmacology. The compound may exhibit interesting pharmacological properties, potentially acting as a neurotransmitter or modulator due to its structural similarity to biologically active molecules. Overall, its unique structural features suggest potential utility in drug development and research into indole derivatives.

Formula: C₁₁H₁₄ClFN₂

InChI: InChI=1/C11H13FN2.ClH/c1-7(13)4-8-6-14-11-3-2-9(12)5-10(8)11;/h2-3,5-7,14H,4,13H2,1H3;1H

InChI key: InChIKey=CTGFDWBZMCPVED-UHFFFAOYSA-N

SMILES: CC(Cc1c[nH]c2ccc(cc12)F)N.Cl

5-Fluoro-alpha-Methyltryptamine

Controlled Product

CAS: 712-08-3

5-Fluoro-alpha-methyltryptamine is a metabolite of tryptamine, an endogenous trace amine that is found in the mammalian brain and peripheral tissues. 5-Fluoro-alpha-methyltryptamine is also a metabolite of amphetamine and has been shown to be psychoactive in vivo. It has been reported to have inhibitory properties on signal pathways involving serotonin and dopamine, which may contribute to its anti-depressant effects. 5-Fluoro-alpha-methyltryptamine has been used as a research chemical for human studies and medications that are selective for the 5HT2 receptors.

Formula: C₁₁H₁₄ClFN₂

Purity: Min. 95%

Molecular weight: 228.69 g/mol

Ref: 3D-FF79908