CAS 712-30-1
:6-Formylpterin
Description:
6-Formylpterin is a chemical compound that belongs to the class of pterins, which are bicyclic compounds containing a pteridine ring system. It is characterized by the presence of a formyl group (-CHO) at the 6-position of the pterin structure. This compound is typically a yellow to orange crystalline solid and is soluble in polar solvents such as water and methanol. 6-Formylpterin plays a significant role in biological systems, particularly in the metabolism of folate and related compounds. It is involved in various biochemical pathways, including those related to the synthesis of nucleic acids and amino acids. The compound can also exhibit fluorescence, making it useful in certain analytical applications. Additionally, 6-Formylpterin has been studied for its potential roles in cellular signaling and as a precursor in the synthesis of other biologically active molecules. Its reactivity and properties make it an interesting subject for research in both organic chemistry and biochemistry.
Formula:C7H5N5O2
InChI:InChI=1S/C7H5N5O2/c8-7-11-5-4(6(14)12-7)10-3(2-13)1-9-5/h1-2H,(H3,8,9,11,12,14)
InChI key:InChIKey=LLJAQDVNMGLRBD-UHFFFAOYSA-N
SMILES:O=C1C=2C(=NC(N)=N1)NC=C(C=O)N2
Synonyms:- 2-Amino-3,4-dihydro-4-oxo-6-pteridinecarboxaldehyde
- 2-Amino-4-hydroxy-6-formylpteridine
- 2-Amino-4-hydroxy-6-pteridylcarboxaldehyde
- 2-Amino-4-hydroxypteridine-6-carbaldehyde
- 2-Amino-4-hydroxypteridine-6-carboxaldehyde
- 2-Amino-4-oxo-1H-pteridine-6-carbaldehyde
- 2-Amino-4-oxo-3,4-dihydropteridine-6-carbaldehyde
- 2-Amino-6-formylpteridin-4-one
- 6-Formylpterin
- 6-Pteridinecarboxaldehyde, 2-Amino-4-Hydroxy-
- 6-Pteridinecarboxaldehyde, 2-amino-1,4-dihydro-4-oxo-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-Pteridinecarboxaldehyde,2-amino-3,4-dihydro-4-oxo-
CAS:Formula:C7H5N5O2Purity:95%Color and Shape:SolidMolecular weight:191.14696-Formylpterin
CAS:<p>6-Formylpterin (Pterin-6-aldehyde) is an inhibitor of Xanthine Oxidase, which induces ROS generation and apoptosis in HL-60 cells.</p>Formula:C7H5N5O2Purity:98%Color and Shape:SolidMolecular weight:191.152-Amino-6-formylpteridin-4-one
CAS:<p>2-Amino-6-formylpteridin-4-one is a reactive compound that can cause oxidative injury in humans. It has been shown to cause hydrogen bond cleavage and the loss of structural integrity in human serum. 2-Amino-6-formylpteridin-4-one also induces apoptosis by inhibiting the mitochondrial membrane potential and releasing cytochrome c from the mitochondria into the cytosol. 2-Amino-6-formylpteridin-4-one is an inhibitor of binding to anion radicals, which may be beneficial for treating skin disorders such as psoriasis.</p>Formula:C7H5N5O2Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:191.15 g/mol







