CAS 7120-25-4

2,3-dimethylquinoline-4-carboxylic acid

Description:

2,3-Dimethylquinoline-4-carboxylic acid is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features two methyl groups at the 2 and 3 positions of the quinoline ring and a carboxylic acid functional group at the 4 position. It typically appears as a solid or crystalline substance and is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the methyl groups contribute to the compound's hydrophobic characteristics, influencing its solubility and reactivity. 2,3-Dimethylquinoline-4-carboxylic acid may also exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1/C12H11NO2/c1-7-8(2)13-10-6-4-3-5-9(10)11(7)12(14)15/h3-6H,1-2H3,(H,14,15)

SMILES: Cc1c(C)nc2ccccc2c1C(=O)O

Synonyms:

• 4-Quinolinecarboxylic Acid, 2,3-Dimethyl-

2,3-Dimethylquinoline-4-carboxylic acid

CAS: 7120-25-4

Versatile small molecule scaffold

Formula: C₁₂H₁₁NO₂

Purity: Min. 95%

Molecular weight: 201.22 g/mol

Ref: 3D-HAA12025