CAS 71202-91-0
:(5R)-3-amino-5-methyl-5-phenylimidazolidine-2,4-dione
Description:
(5R)-3-amino-5-methyl-5-phenylimidazolidine-2,4-dione, also known by its CAS number 71202-91-0, is a chemical compound characterized by its imidazolidine structure, which features a five-membered ring containing two nitrogen atoms. This compound exhibits a chiral center at the 5-position, contributing to its specific stereochemistry, which is crucial for its biological activity. The presence of an amino group at the 3-position and a phenyl group at the 5-position enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. The dione functional groups at positions 2 and 4 indicate that it can participate in various chemical reactions, such as nucleophilic attacks or coordination with metal ions. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and pharmaceuticals. Overall, this compound's unique structural features and functional groups make it a subject of interest for further studies in drug development and biochemical applications.
Formula:C10H11N3O2
InChI:InChI=1/C10H11N3O2/c1-10(7-5-3-2-4-6-7)8(14)13(11)9(15)12-10/h2-6H,11H2,1H3,(H,12,15)/t10-/m1/s1
SMILES:C[C@@]1(c2ccccc2)C(=O)N(C(=N1)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
