CAS 71204-93-8
:2-fluorobenzenecarboximidamide
Description:
2-Fluorobenzenecarboximidamide, with the CAS number 71204-93-8, is an organic compound characterized by the presence of a fluorine atom attached to a benzene ring, which is further substituted with a carboximidamide functional group. This compound typically exhibits properties associated with both aromatic compounds and amides, including potential solubility in polar solvents due to the presence of the amide group. The fluorine substituent can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other chemical species. As a carboximidamide, it may participate in hydrogen bonding, which can affect its physical properties such as melting and boiling points. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the benzene ring can lead to variations in biological activity. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature reviews.
Formula:C7H7FN2
InChI:InChI=1/C7H7FN2/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H3,9,10)
SMILES:c1ccc(c(c1)C(=N)N)F
Synonyms:- Benzenecarboximidamide, 2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Fluorobenzene-1-carboximidamide
CAS:2-Fluorobenzene-1-carboximidamide
Molecular weight:138.14228g/mol


