CAS 71205-41-9
:N-[3-(Methylthio)phenyl]thiourea
Description:
N-[3-(Methylthio)phenyl]thiourea, with the CAS number 71205-41-9, is an organic compound characterized by the presence of a thiourea functional group and a methylthio substituent on a phenyl ring. This compound typically exhibits properties associated with thioureas, such as being a white to off-white crystalline solid. It is soluble in polar organic solvents, which is common for many thiourea derivatives. The methylthio group enhances its reactivity and may influence its biological activity, making it of interest in various chemical and pharmaceutical applications. Thioureas are known for their ability to form hydrogen bonds and participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, compounds like N-[3-(Methylthio)phenyl]thiourea may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H10N2S2
InChI:InChI=1S/C8H10N2S2/c1-12-7-4-2-3-6(5-7)10-8(9)11/h2-5H,1H3,(H3,9,10,11)
InChI key:InChIKey=LXQSOEIIWYHVFA-UHFFFAOYSA-N
SMILES:N(C(N)=S)C1=CC(SC)=CC=C1
Synonyms:- 1-[3-(Methylthio)phenyl]-2-thiourea
- N-[3-(methylthio)phenyl]thiourea
- Thiourea, N-[3-(methylthio)phenyl]-
- Thiourea, [3-(methylthio)phenyl]-
- [3-(Methylsulfanyl)phenyl]thiourea
- 1-[3-(Methylsulfanyl)phenyl]thiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
