CAS 71207-33-5
:N-(piperidin-4-ylmethyl)acetamide
Description:
N-(piperidin-4-ylmethyl)acetamide, with the CAS number 71207-33-5, is an organic compound characterized by its amide functional group, which is derived from acetic acid and piperidine. This compound features a piperidine ring, a six-membered saturated nitrogen-containing heterocycle, which contributes to its biological activity and solubility properties. The presence of the acetamide group enhances its potential as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. Typically, such compounds exhibit moderate to high polarity due to the amide bond, which can influence their interactions with biological targets. The molecular structure allows for potential hydrogen bonding, which is crucial for solubility in polar solvents and biological systems. Additionally, N-(piperidin-4-ylmethyl)acetamide may exhibit various pharmacological properties, making it of interest in drug discovery and development. Its stability, reactivity, and compatibility with other chemical entities are essential considerations in synthetic applications and formulation processes.
Formula:C8H16N2O
InChI:InChI=1/C8H16N2O/c1-7(11)10-6-8-2-4-9-5-3-8/h8-9H,2-6H2,1H3,(H,10,11)
SMILES:CC(=NCC1CCNCC1)O
Synonyms:- Acetamide, N-(4-piperidinylmethyl)-
- N-(Piperidin-4-ylmethyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
