CAS 71208-01-0: [(3S,4S,5S,6S)-6-[(3S,4R,5S,6S)-5-acetamido-6-benzyloxy-2-(benzyloxymethyl)-4-hydroxy-tetrahydropyran-3-yl]oxy-3,4,5-triacetoxy-tetrahydropyran-2-yl]methyl acetate
Description:The chemical substance with the name "[(3S,4S,5S,6S)-6-[(3S,4R,5S,6S)-5-acetamido-6-benzyloxy-2-(benzyloxymethyl)-4-hydroxy-tetrahydropyran-3-yl]oxy-3,4,5-triacetoxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 71208-01-0 is a complex organic compound characterized by its intricate stereochemistry and multiple functional groups. It features a tetrahydropyran backbone, which is a six-membered cyclic ether, and incorporates several acetoxy groups, indicating the presence of ester functionalities. The compound also contains acetamido and benzyloxy substituents, which contribute to its potential biological activity and solubility properties. The stereochemical configuration, denoted by the (S) and (R) designations, suggests that the compound may exhibit specific interactions in biological systems, making it of interest in medicinal chemistry. Its structural complexity may also influence its reactivity and stability under various conditions. Overall, this compound exemplifies the diversity of organic molecules and their potential applications in pharmaceuticals or biochemistry.
Formula:C36H45NO15
InChI:InChI=1/C36H45NO15/c1-20(38)37-29-30(43)31(27(18-44-16-25-12-8-6-9-13-25)50-35(29)46-17-26-14-10-7-11-15-26)52-36-34(49-24(5)42)33(48-23(4)41)32(47-22(3)40)28(51-36)19-45-21(2)39/h6-15,27-36,43H,16-19H2,1-5H3,(H,37,38)/t27?,28?,29-,30+,31+,32-,33-,34-,35-,36-/m0/s1

2-Acetamido-4-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-1,6-di-O-benzyl-2-deoxy-a-D-glucopyranoside
Ref: 7W-GC1829
Undefined size | To inquire |

2-Acetamido-4-O-(2,3,4,6-tetra-O-acetyl-b-D-galactopyranosyl)-1,6-di-O-benzyl-2-deoxy-a-D-glucopyranoside
Ref: 3D-OA05716
50mg | 305.00 € | ||
100mg | 419.00 € | ||
250mg | 744.00 € |