CAS 71219-80-2

1-isocyanato-3-(phenoxymethyl)benzene

Description:

1-Isocyanato-3-(phenoxymethyl)benzene, with the CAS number 71219-80-2, is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a phenyl ring that is further substituted with a phenoxymethyl group. This compound typically exhibits reactivity associated with isocyanates, making it useful in various applications, particularly in the synthesis of polyurethanes and other polymers. The presence of the phenoxymethyl group can influence its solubility and reactivity, potentially enhancing its compatibility with other organic materials. In terms of physical properties, it may be a solid at room temperature, with a specific melting point and boiling point that would depend on its molecular structure. Safety considerations are important, as isocyanates are known to be irritants and can pose health risks upon exposure. Therefore, handling this compound requires appropriate safety measures, including the use of personal protective equipment and working in well-ventilated areas.

Formula: C₁₄H₁₁NO₂

InChI: InChI=1/C14H11NO2/c16-11-15-13-6-4-5-12(9-13)10-17-14-7-2-1-3-8-14/h1-9H,10H2

SMILES: c1ccc(cc1)OCc1cccc(c1)N=C=O

1-Isocyanato-3-(phenoxymethyl)benzene

CAS: 71219-80-2

1-Isocyanato-3-(phenoxymethyl)benzene

Purity: 95%

Molecular weight: 225.247g/mol

Ref: 54-OR97795