CAS 7123-76-4
:3-(4-nitrophenyl)adamantane-1-carboxylic acid
Description:
3-(4-Nitrophenyl)adamantane-1-carboxylic acid, with the CAS number 7123-76-4, is a chemical compound characterized by its adamantane core structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound features a carboxylic acid functional group (-COOH) at the 1-position and a para-nitrophenyl group at the 3-position of the adamantane framework. The presence of the nitro group (-NO2) contributes to its electron-withdrawing properties, which can influence its reactivity and solubility in various solvents. The carboxylic acid group allows for potential hydrogen bonding and increases the compound's polarity, affecting its interactions in biological systems and chemical reactions. This compound may exhibit interesting pharmacological properties due to its unique structure, making it a subject of interest in medicinal chemistry and materials science. Its stability and functional groups also make it suitable for various synthetic applications, including the development of novel drugs or materials.
Formula:C17H19NO4
InChI:InChI=1/C17H19NO4/c19-15(20)17-8-11-5-12(9-17)7-16(6-11,10-17)13-1-3-14(4-2-13)18(21)22/h1-4,11-12H,5-10H2,(H,19,20)
SMILES:c1cc(ccc1C12CC3CC(C1)CC(C3)(C2)C(=O)O)N(=O)=O
Synonyms:- 3-(4-Nitrophenyl)Tricyclo[3.3.1.1~3,7~]Decane-1-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(4-Nitrophenyl)adamantane-1-carboxylic acid
CAS:Formula:C17H19NO4Color and Shape:SolidMolecular weight:301.33713-(4-Nitrophenyl)adamantane-1-carboxylic acid
CAS:3-(4-Nitrophenyl)adamantane-1-carboxylic acidFormula:C17H19NO4Purity:97%Color and Shape: pale yellow crystalline solidMolecular weight:301.34g/mol3-(4-Nitrophenyl)-1-adamantanecarboxylic acid
CAS:3-(4-Nitrophenyl)-1-adamantanecarboxylic acid is a high quality, versatile building block compound that has been used as a reagent and as a useful intermediate. This product is commercially available and can be used in the synthesis of complex compounds with many different applications, such as pharmaceuticals, pesticides, dyes, and photographic chemicals. It is also a useful scaffold for the production of speciality chemicals and research chemicals. 3-(4-Nitrophenyl)-1-adamantanecarboxylic acid has been used in reactions involving electron transfer, nucleophilic substitution, and condensation reactions.Formula:C17H19NO4Purity:Min. 95%Molecular weight:301.34 g/mol


