CymitQuimica logo

CAS 712317-60-7

:

5-fluoro-2-methyl-4-(pyrrolidin-1-yl)benzaldehyde

Description:
5-Fluoro-2-methyl-4-(pyrrolidin-1-yl)benzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group and a pyrrolidine moiety. The presence of a fluorine atom at the 5-position of the benzene ring contributes to its unique reactivity and potential biological activity. The methyl group at the 2-position and the pyrrolidinyl substituent at the 4-position enhance its steric and electronic properties, making it a compound of interest in medicinal chemistry and drug development. This compound may exhibit various properties such as solubility in organic solvents, and its reactivity can be influenced by the electron-withdrawing nature of the fluorine atom. Additionally, the pyrrolidine ring can impart specific conformational characteristics that may affect its interaction with biological targets. Overall, 5-fluoro-2-methyl-4-(pyrrolidin-1-yl)benzaldehyde is a versatile compound with potential applications in pharmaceuticals and chemical research.
Formula:C12H14FNO
InChI:InChI=1/C12H14FNO/c1-9-6-12(14-4-2-3-5-14)11(13)7-10(9)8-15/h6-8H,2-5H2,1H3
SMILES:Cc1cc(c(cc1C=O)F)N1CCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.