CAS 712319-11-4
:4,5,6,7-Tetrahydro-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Description:
4,5,6,7-Tetrahydro-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a complex organic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates a tetrahydro ring system and a carboxylic acid functional group. The presence of the pentafluoroethyl substituent significantly influences its chemical properties, imparting high electronegativity and altering its reactivity and solubility. This compound is likely to exhibit interesting biological activity due to its structural features, making it a candidate for pharmaceutical applications. Its synthesis involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Additionally, the compound's stability, solubility in various solvents, and potential interactions with biological targets are important characteristics that would be evaluated in research contexts. Overall, this compound represents a fascinating area of study within medicinal chemistry and material science.
Formula:C10H10F5N3O2
InChI:InChI=1S/C10H10F5N3O2/c1-4-2-6(9(11,12)10(13,14)15)18-7(16-4)3-5(17-18)8(19)20/h3-4,6,16H,2H2,1H3,(H,19,20)
InChI key:InChIKey=PLAYSRYCRLUCFT-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(F)(F)C1N2C(=CC(C(O)=O)=N2)NC(C)C1
Synonyms:- Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 4,5,6,7-tetrahydro-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)-
- 4,5,6,7-Tetrahydro-5-methyl-7-(1,1,2,2,2-pentafluoroethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
- Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 4,5,6,7-tetrahydro-5-methyl-7-(pentafluoroethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.