CAS 712319-12-5

6-(2-Hydroxyethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:

6-(2-Hydroxyethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a hydroxyethyl group enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature are studied for their potential pharmacological properties, including anti-inflammatory or anti-cancer activities, due to the presence of heterocyclic rings that can interact with biological targets. The molecular structure allows for various functional modifications, which can be explored for drug development. Additionally, the compound's CAS number, 712319-12-5, serves as a unique identifier for regulatory and research purposes, facilitating its study in chemical databases and literature. Overall, this compound represents a class of heterocyclic compounds with significant potential in medicinal chemistry.

Formula: C₉H₉N₃O₃

InChI: InChI=1S/C9H9N3O3/c13-2-1-6-4-10-8-3-7(9(14)15)11-12(8)5-6/h3-5,13H,1-2H2,(H,14,15)

InChI key: InChIKey=HEYXKTSVKRVGOU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN2C(=C1)N=CC(CCO)=C2

Synonyms:

• 6-(2-Hydroxyethyl)pyrazolo[1,5-a]pyrimidine-2-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 6-(2-hydroxyethyl)-

6-(2-Hydroxy-ethyl)-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid

CAS: 712319-12-5

Formula: C₉H₉N₃O₃

Purity: 95.0%

Molecular weight: 207.189

Ref: 10-F059334