
CAS 712344-79-1
:N-(3,4-Difluorophenyl)-2-[(1-methyl-1H-tetrazol-5-yl)thio]acetamide
Description:
N-(3,4-Difluorophenyl)-2-[(1-methyl-1H-tetrazol-5-yl)thio]acetamide, with CAS number 712344-79-1, is a chemical compound characterized by its unique structural features, including a difluorophenyl group and a tetrazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the difluorophenyl group may enhance lipophilicity and influence the compound's interaction with biological targets. The tetrazole ring is known for its ability to participate in hydrogen bonding and can contribute to the compound's pharmacological properties. Additionally, the thioacetamide functional group may impart specific reactivity and stability characteristics. Overall, this compound's structural attributes suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, detailed studies on its biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses and implications in drug development.
Formula:C10H9F2N5OS
InChI:InChI=1S/C10H9F2N5OS/c1-17-10(14-15-16-17)19-5-9(18)13-6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3,(H,13,18)
InChI key:InChIKey=BCCIVOWPJUBCBK-UHFFFAOYSA-N
SMILES:S(CC(NC1=CC(F)=C(F)C=C1)=O)C=2N(C)N=NN2
Synonyms:- Acetamide, N-(3,4-difluorophenyl)-2-[(1-methyl-1H-tetrazol-5-yl)thio]-
- N-(3,4-Difluorophenyl)-2-[(1-methyl-1H-tetrazol-5-yl)thio]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.