CAS 71247-78-4

Salaspermic acid

Description:

Salaspermic acid, with the CAS number 71247-78-4, is a chemical compound that belongs to the class of natural products. It is primarily derived from certain plant sources and is known for its potential biological activities. The compound typically exhibits characteristics such as being a solid at room temperature, with a specific melting point that can vary based on purity and environmental conditions. Salaspermic acid is often studied for its pharmacological properties, including potential anti-inflammatory and antimicrobial effects. Its molecular structure includes functional groups that contribute to its reactivity and interaction with biological systems. Additionally, it may have applications in medicinal chemistry and natural product synthesis. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the biological effects can vary based on concentration and exposure routes. Overall, salaspermic acid represents an interesting area of study within the field of natural product chemistry.

Formula: C₃₀H₄₈O₄

InChI: InChI=1/C30H48O4/c1-19-29-9-7-20-26(4,21(29)8-10-30(19,33)34-18-29)14-16-28(6)22-17-25(3,23(31)32)12-11-24(22,2)13-15-27(20,28)5/h19-22,33H,7-18H2,1-6H3,(H,31,32)/t19-,20?,21?,22?,24-,25-,26-,27-,28+,29?,30?/m1/s1

InChI key: InChIKey=ZXENWDWQTWYUGY-UUZWCOCASA-N

SMILES: C[C@@H]1[C@]23[C@]([C@@]4(C)[C@](CC2)([C@]5(C)[C@@](C)(CC4)[C@]6([C@@](C)(CC5)CC[C@](C(O)=O)(C)C6)[H])[H])(CC[C@]1(O)OC3)[H]

Synonyms:

• 2H-3,4a-(Epoxymethano)picene-11-carboxylic acid, eicosahydro-3-hydroxy-4,6b,8a,11,12b,14a-hexamethyl-, [3S-(3α,4α,4aα,6aβ,6bα,8aα,11β,12aα,12bβ,14aα,14bβ)]-
• 2H-3,4a-(Epoxymethano)picene-11-carboxylic acid, eicosahydro-3-hydroxy-4,6b,8a,11,12b,14a-hexamethyl-, (3S,4R,4aR,6aS,6bR,8aS,11R,12aR,12bS,14aR,14bS)-
• Salaspermic acid
• (3S,4R,4aR,6aS,6bR,8aS,11R,12aR,12bS,14aR,14bS)-Eicosahydro-3-hydroxy-4,6b,8a,11,12b,14a-hexamethyl-2H-3,4a-(epoxymethano)picene-11-carboxylic acid
• D:A-Friedooleanan-29-oic acid, 3,24-epoxy-3-hydroxy-, (3β,20α)-
• Aids-060359
• Aids060359

Salaspermic acid

CAS: 71247-78-4

Salaspermic acid, an isolate from Kokoona ochracea, is an inhibitor of HIV reverse transcriptase and HIV replication in H9 lymphocytes.

Formula: C₃₀H₄₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 472.7

Ref: TM-TN4934

Salaspermic acid

CAS: 71247-78-4

Formula: C₃₀H₄₈O₄

Purity: 95%~99%

Molecular weight: 472.71

Ref: BP-SBP03531

Salaspermic acid

CAS: 71247-78-4

Salaspermic acid is a naturally derived compound, which is an organic acid sourced from certain plant species, notably those within the Salsola genus. It possesses a unique biochemical structure that allows interaction with specific biological pathways, though the precise mode of action is not fully elucidated. It is hypothesized to modulate signaling pathways, potentially impacting metabolic and inflammatory processes.

Formula: C₃₀H₄₈O₄

Purity: Min. 95%

Molecular weight: 472.7 g/mol

Ref: 3D-WCA24778