CymitQuimica logo

CAS 7125-70-4

:

6,7-dimethoxyquinolin-4-amine hydrochloride hydrate

Description:
6,7-Dimethoxyquinolin-4-amine hydrochloride hydrate is a chemical compound characterized by its quinoline structure, which features a nitrogen-containing bicyclic aromatic system. The presence of two methoxy groups at the 6 and 7 positions enhances its solubility and reactivity. As an amine, it possesses basic properties, allowing it to form salts, such as the hydrochloride form, which is typically more stable and soluble in water. The hydrate form indicates that the compound contains water molecules in its crystalline structure, which can influence its physical properties, such as melting point and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. Its specific applications and mechanisms of action would depend on further studies and investigations. Overall, 6,7-dimethoxyquinolin-4-amine hydrochloride hydrate is a versatile compound with potential utility in various chemical and biological contexts.
Formula:C11H15ClN2O3
InChI:InChI=1/C11H12N2O2.ClH.H2O/c1-14-10-5-7-8(12)3-4-13-9(7)6-11(10)15-2;;/h3-6H,1-2H3,(H2,12,13);1H;1H2
SMILES:COc1cc2c(=N)cc[nH]c2cc1OC.Cl.O
Synonyms:
  • 6,7-Dimethoxy-4-quinolinamine Monohydrochloride Monohydrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.