CAS 71254-70-1
:Ethyl 1,2-dimethyl-1H-benzimidazole-5-carboxylate
Description:
Ethyl 1,2-dimethyl-1H-benzimidazole-5-carboxylate, with the CAS number 71254-70-1, is a chemical compound that belongs to the class of benzimidazole derivatives. This compound features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring, contributing to its biological activity and potential pharmacological properties. The presence of ethyl and dimethyl substituents enhances its solubility and reactivity. Typically, compounds of this nature exhibit a range of biological activities, including antimicrobial and antifungal properties, making them of interest in medicinal chemistry. The carboxylate functional group can participate in various chemical reactions, such as esterification and amidation, which are useful in synthetic organic chemistry. Additionally, the compound's structure suggests potential interactions with biological targets, which can be explored for therapeutic applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-4-16-12(15)9-5-6-11-10(7-9)13-8(2)14(11)3/h5-7H,4H2,1-3H3
InChI key:InChIKey=SVAVKHFAEWFWDR-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C(OCC)=O)=CC2)N=C1C
Synonyms:- 1H-Benzimidazole-5-carboxylic acid, 1,2-dimethyl-, ethyl ester
- Ethyl 1,2-dimethyl-1H-benzimidazole-5-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
