CAS 71259-54-6
:4-chloro-N-hydroxy-2-methylaniline
Description:
4-Chloro-N-hydroxy-2-methylaniline, with the CAS number 71259-54-6, is an organic compound characterized by the presence of a chloro group, a hydroxyl group, and an aniline structure. This compound features a chlorine atom attached to the fourth position of a benzene ring, while a hydroxyl group is bonded to the nitrogen atom of the aniline moiety. The presence of the methyl group at the second position contributes to its overall hydrophobic character. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group. The compound is of interest in various chemical applications, including as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Its reactivity can be influenced by the electron-withdrawing nature of the chloro group and the electron-donating properties of the hydroxyl and amino groups, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and potential toxicity, as with many chemical substances.
Formula:C7H8ClNO
InChI:InChI=1/C7H8ClNO/c1-5-4-6(8)2-3-7(5)9-10/h2-4,9-10H,1H3
SMILES:Cc1cc(ccc1NO)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.