CAS 7126-01-4
:2,2-Dichloro-1,1,1-trifluoropropane
Description:
2,2-Dichloro-1,1,1-trifluoropropane, with the CAS number 7126-01-4, is a halogenated organic compound that belongs to the class of chlorofluorocarbons (CFCs). It is characterized by its molecular formula C3HCl2F3, indicating the presence of two chlorine atoms and three fluorine atoms attached to a propane backbone. This compound is typically a colorless liquid at room temperature and has a relatively low boiling point, making it useful in various applications, including as a refrigerant and solvent. 2,2-Dichloro-1,1,1-trifluoropropane is known for its stability and resistance to degradation, which contributes to its persistence in the environment. However, like many halogenated compounds, it has raised concerns regarding its potential impact on ozone depletion and greenhouse gas effects. Safety measures should be taken when handling this substance, as it can pose health risks, including respiratory irritation and potential effects on the central nervous system. Proper storage and disposal are essential to mitigate environmental and health hazards associated with its use.
Formula:C3H3Cl2F3
InChI:InChI=1S/C3H3Cl2F3/c1-2(4,5)3(6,7)8/h1H3
InChI key:InChIKey=DCWQLZUJMHEDKD-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C)(Cl)Cl
Synonyms:- 1,1,1-Trifluoro-2,2-dichloropropane
- HCFC 243ab
- Propane, 2,2-Dichloro-1,1,1-Trifluoro-
- 2,2-Dichloro-1,1,1-trifluoropropane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.