CymitQuimica logo

CAS 7126-50-3

:

ethyl 5-formyl-1H-pyrrole-2-carboxylate

Description:
Ethyl 5-formyl-1H-pyrrole-2-carboxylate, identified by its CAS number 7126-50-3, is an organic compound that features a pyrrole ring, which is a five-membered aromatic heterocycle containing nitrogen. This compound is characterized by the presence of both an aldehyde group (formyl) and an ester group (ethyl carboxylate) attached to the pyrrole structure. The molecular structure contributes to its reactivity, making it a potential intermediate in various organic synthesis reactions, particularly in the formation of more complex molecules. Ethyl 5-formyl-1H-pyrrole-2-carboxylate may exhibit properties such as solubility in organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, compounds of this type are often studied for their biological activities, including potential applications in pharmaceuticals and agrochemicals. Overall, the unique combination of functional groups in this compound makes it of interest in both synthetic and medicinal chemistry.
Formula:C8H9NO3
InChI:InChI=1/C8H9NO3/c1-2-12-8(11)7-4-3-6(5-10)9-7/h3-5,9H,2H2,1H3
InChI key:HTPFMOGFQKDFHX-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc(C=O)[nH]1
Synonyms:
  • 1H-Pyrrole-2-carboxylic acid, 5-formyl-, ethyl ester
  • Ethyl 5-formyl-1H-pyrrole-2-carboxylate
Found 4 products.