CAS 71260-16-7

1-(2-methylpropanoyl)piperazine

Description:

1-(2-Methylpropanoyl)piperazine, with the CAS number 71260-16-7, is an organic compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This compound features a 2-methylpropanoyl group attached to the nitrogen atom of the piperazine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the carbonyl group in the acyl chain allows for potential reactivity in various chemical reactions, such as acylation and condensation. This compound may exhibit moderate solubility in polar solvents due to the presence of the piperazine moiety, which can engage in hydrogen bonding. Additionally, it may possess biological activity, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed, as with all chemical substances, to ensure safe usage in laboratory or industrial settings.

Formula: C₈H₁₆N₂O

InChI: InChI=1/C8H16N2O/c1-7(2)8(11)10-5-3-9-4-6-10/h7,9H,3-6H2,1-2H3

SMILES: CC(C)C(=O)N1CCNCC1

Synonyms:

• 1-Propanone, 2-methyl-1-(1-piperazinyl)-
• 2-Methyl-1-(piperazin-1-yl)propan-1-one

2-Methyl-1-(1-piperazinyl)-1-propanone

CAS: 71260-16-7

Formula: C₈H₁₆N₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 156.2254

Ref: IN-DA005VTW

2-Methyl-1-(piperazin-1-yl)propan-1-one

CAS: 71260-16-7

2-Methyl-1-(piperazin-1-yl)propan-1-one

Purity: 97%

Color and Shape: Colourless Liquid

Molecular weight: 156.23g/mol

Ref: 54-OR0858

1-(2-Methylpropanoyl)-piperazine

CAS: 71260-16-7

Formula: C₈H₁₆N₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 156.229

Ref: 10-F024332

2-Methyl-1-(piperazin-1-yl)propan-1-one

CAS: 71260-16-7

Versatile small molecule scaffold

Formula: C₈H₁₆N₂O

Purity: Min. 95%

Molecular weight: 156.23 g/mol

Ref: 3D-WCA26016