CymitQuimica logo

CAS 71261-13-7

:

1,2,5-trimethyl-3,4-dinitrobenzene

Description:
1,2,5-Trimethyl-3,4-dinitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with three methyl groups and two nitro groups. The presence of the nitro groups introduces significant electron-withdrawing characteristics, influencing the compound's reactivity and stability. This compound is typically a yellow crystalline solid at room temperature and is known for its relatively low solubility in water, while being more soluble in organic solvents. It exhibits properties typical of nitro-substituted aromatic compounds, such as potential explosive characteristics under certain conditions. The methyl groups contribute to steric hindrance, which can affect the compound's reactivity and interactions with other chemicals. Due to its nitro groups, it may also participate in electrophilic aromatic substitution reactions. Safety precautions are essential when handling this compound, as it may pose health risks, including toxicity and environmental hazards. Overall, 1,2,5-trimethyl-3,4-dinitrobenzene is of interest in various chemical applications, including research and development in materials science and explosives.
Formula:C9H10N2O4
InChI:InChI=1/C9H10N2O4/c1-5-4-6(2)8(10(12)13)9(7(5)3)11(14)15/h4H,1-3H3
SMILES:Cc1cc(C)c(c(c1C)N(=O)=O)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.